|
|
| | 3-Methoxy-2-Methyl-pyran-4-one Basic information |
| Product Name: | 3-Methoxy-2-Methyl-pyran-4-one | | Synonyms: | 3-Methoxy-2-Methyl-pyran-4-one;3-Methoxy-2-Methyl-4H-pyran-4-one;2-Methyl-3-methoxy-4H-pyran-4-one;3-methoxy-2-methyl-4-pyranone;InChI=1/C7H8O3/c1-5-7(9-2)6(8)3-4-10-5/h3-4H,1-2H;MFCD14553191;Pantoprazole Impurity 40;3-methoxy-2-methyl-4H-pyran
-4-one 3-Methoxy-2-methyl-4H-pyran-4-on | | CAS: | 4780-14-7 | | MF: | C7H8O3 | | MW: | 140.14 | | EINECS: | 610-382-6 | | Product Categories: | | | Mol File: | 4780-14-7.mol |  |
| | 3-Methoxy-2-Methyl-pyran-4-one Chemical Properties |
| Boiling point | 85-89 °C(Press: 3.5 Torr) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | LogP | 0.262 (est) |
| | 3-Methoxy-2-Methyl-pyran-4-one Usage And Synthesis |
| Uses | 3-Methoxy-2-methyl-4H-pyran-4-one is a reagent used in the synthesis of Staphylococcus antibacterials. |
| | 3-Methoxy-2-Methyl-pyran-4-one Preparation Products And Raw materials |
|