|
|
| | 3,3''-DibroMo-1,1':3',1''-terphenyl Basic information |
| Product Name: | 3,3''-DibroMo-1,1':3',1''-terphenyl | | Synonyms: | 3,3''-DibroMo-1,1':3',1''-terphenyl;1,3-Bis(3-bromophenyl)benzene;3,3''-dibromo-1,1':3',1''-Terpheny;1,1':3',1''-Terphenyl, 3,3''-dibromo-;3,3''-Dibromo-m-terphenyl;3,3''-Dibromo-1,1':3',1''-terphenyl b;3,3''-Dibromo-1,1':3',1''-terphenyl;3,3“-dibromo-1,1':3',1"-terphenyl | | CAS: | 95962-62-2 | | MF: | C18H12Br2 | | MW: | 388.1 | | EINECS: | | | Product Categories: | | | Mol File: | 95962-62-2.mol |  |
| | 3,3''-DibroMo-1,1':3',1''-terphenyl Chemical Properties |
| Melting point | 53.0 to 57.0 °C | | Boiling point | 225°C/0.4mmHg(lit.) | | density | 1.537±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C18H12Br2/c19-17-8-2-6-15(11-17)13-4-1-5-14(10-13)16-7-3-9-18(20)12-16/h1-12H | | InChIKey | FGKHIPSLESGJNR-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC(C3=CC=CC(Br)=C3)=C2)=CC=CC(Br)=C1 |
| RIDADR | 3152 | | HS Code | 2903.99.8001 | | HazardClass | 9 | | PackingGroup | II |
| | 3,3''-DibroMo-1,1':3',1''-terphenyl Usage And Synthesis |
| Chemical Properties | off-white powder |
| | 3,3''-DibroMo-1,1':3',1''-terphenyl Preparation Products And Raw materials |
|