Company Name: |
R K Synthesis Limited
|
Tel: |
+91-9825095198 +91-9825095198 |
Email: |
info@rksynthesis.com |
Products Intro: |
Product Name:Bis-(4-chloro-3-nitrophenyl)-sulfone CAS:1759-05-3 Purity:99% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| bis(4-chloro-3-nitrophenyl) sulphone Basic information |
Product Name: | bis(4-chloro-3-nitrophenyl) sulphone | Synonyms: | bis(4-chloro-3-nitrophenyl) sulphone;1-chloro-4-(4-chloro-3-nitrophenylsulfonyl)-2-nitroenzene;4,4'-Dichloro-3,3'-dinitrodiphenyl sulfone;1,1'-sulfonylbis[4-chloro-3-nitro-Benzene;bis(4-chloro-3-nitrophenyl)sulfone;4,4'-Sulfonylbis(1-chloro-2-nitrobenzene);Benzene,1,1'-sulfonylbis[4-chloro-3-nitro- | CAS: | 1759-05-3 | MF: | C12H6Cl2N2O6S | MW: | 377.16 | EINECS: | 217-159-9 | Product Categories: | | Mol File: | 1759-05-3.mol | |
| bis(4-chloro-3-nitrophenyl) sulphone Chemical Properties |
Melting point | 202 °C | Boiling point | 561.0±50.0 °C(Predicted) | density | 1.673±0.06 g/cm3(Predicted) |
RIDADR | 1759 | HazardClass | 8 | PackingGroup | III |
| bis(4-chloro-3-nitrophenyl) sulphone Usage And Synthesis |
| bis(4-chloro-3-nitrophenyl) sulphone Preparation Products And Raw materials |
|