|
| 3-Cyclopropylmethoxy-4-difluoromethoxy-benzoic acid Basic information |
| 3-Cyclopropylmethoxy-4-difluoromethoxy-benzoic acid Chemical Properties |
Melting point | 118-120℃ | Boiling point | 356.4±37.0 °C(Predicted) | density | 1.355±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | DMSO (Slightly), Methanol (Slightly) | form | Solid | pka | 3.87±0.10(Predicted) | color | White to Off-White | InChI | InChI=1S/C12H12F2O4/c13-12(14)18-9-4-3-8(11(15)16)5-10(9)17-6-7-1-2-7/h3-5,7,12H,1-2,6H2,(H,15,16) | InChIKey | IGFDIFLMMLWKKY-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=CC=C(OC(F)F)C(OCC2CC2)=C1 | CAS DataBase Reference | 162401-62-9 |
Hazard Codes | T | Risk Statements | 25 | Safety Statements | 45 | RIDADR | 2811 | HazardClass | 6.1 | PackingGroup | Ⅲ | HS Code | 2918999090 |
| 3-Cyclopropylmethoxy-4-difluoromethoxy-benzoic acid Usage And Synthesis |
Uses | An impurity and intermediate in the preparation of selective phosphodiesterase 4 (PDE4) inhibitor, Roflumilast (R639700). |
| 3-Cyclopropylmethoxy-4-difluoromethoxy-benzoic acid Preparation Products And Raw materials |
|