|
|
| | 7-TETRADECANOL Basic information |
| Product Name: | 7-TETRADECANOL | | Synonyms: | 7-TETRADECANOL 99%;1-Hexyl-1-octanol;7-TETRADECANOL;7-Tetradecanol,99%;tetradecan-7-ol | | CAS: | 3981-79-1 | | MF: | C14H30O | | MW: | 214.39 | | EINECS: | | | Product Categories: | | | Mol File: | 3981-79-1.mol |  |
| | 7-TETRADECANOL Chemical Properties |
| Melting point | 42 °C | | Boiling point | 156 °C / 14mmHg | | density | 0.8097 (estimate) | | refractive index | 1.4237 (estimate) | | pka | 15.47±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C14H30O/c1-3-5-7-9-11-13-14(15)12-10-8-6-4-2/h14-15H,3-13H2,1-2H3 | | InChIKey | FFAQYGTZIMVBFJ-UHFFFAOYSA-N | | SMILES | CCCCCCC(O)CCCCCCC | | CAS DataBase Reference | 3981-79-1 |
| | 7-TETRADECANOL Usage And Synthesis |
| | 7-TETRADECANOL Preparation Products And Raw materials |
|