|
|
| Product Name: | ML-179 | | Synonyms: | ML-179;3-cyclohexyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione;2,4(1H,3H)-Pyrimidinedione, 3-cyclohexyl-6-[4-[3-(trifluoromethyl)phenyl]-1-piperazinyl]-;3-cyclohexyl-6-(4-(3-(trifluoromethyl)phenyl)piperazin-1-yl)pyrimidine-2,4(1H,3H)-dione;C57Bl6 mice,inhibit,SAA4,ER-negative breast cancer,probe compounds,ML 179,MCF-7,SAA1,Inhibitor,ML179,inverse | | CAS: | 1883548-87-5 | | MF: | C21H25F3N4O2 | | MW: | 422.44 | | EINECS: | | | Product Categories: | | | Mol File: | 1883548-87-5.mol |  |
| | ML-179 Chemical Properties |
| density | 1.329±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 10 mg/ml | | form | A crystalline solid | | pka | 9.37±0.40(Predicted) | | InChI | InChI=1S/C21H25F3N4O2/c22-21(23,24)15-5-4-8-17(13-15)26-9-11-27(12-10-26)18-14-19(29)28(20(30)25-18)16-6-2-1-3-7-16/h4-5,8,13-14,16H,1-3,6-7,9-12H2,(H,25,30) | | InChIKey | MFABFKUNLDYKGH-UHFFFAOYSA-N | | SMILES | C1(=O)NC(N2CCN(C3=CC=CC(C(F)(F)F)=C3)CC2)=CC(=O)N1C1CCCCC1 |
| | ML-179 Usage And Synthesis |
| Uses | ML-179 is a potent inverse agonist of liver receptor homolog-1 (LRH-1). It induces the death of estrogen-receptor negative MDA-MB-231 breast cancer cells. | | storage | Store at +4°C |
| | ML-179 Preparation Products And Raw materials |
|