| Company Name: |
Chemwill Asia Co.,Ltd.
|
| Tel: |
86-21-51086038 |
| Email: |
chemwill_asia@126.com |
| Products Intro: |
CAS:2748-40-5
Purity:0.99 Package:5KG;1KG;25KG PRICE quotation Remarks:Factory stock, quality assurance, price concessions
|
| Company Name: |
Henan CoreyChem Co., Ltd
|
| Tel: |
0371-86658258 |
| Email: |
info@coreychem.com |
| Products Intro: |
Product Name:N2,N4,N6-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine
CAS:2748-40-5
Purity:95%-99% Package:1kg;25kg
|
|
| | N2,N4,N6-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine Basic information |
| Product Name: | N2,N4,N6-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine | | Synonyms: | N2,N4,N6-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine;N2,N4,NG-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine;1,3,5-Triazine-2,4,6-triamine, N2,N4,N6-tris(4-chlorophenyl)- | | CAS: | 2748-40-5 | | MF: | C21H15Cl3N6 | | MW: | 457.74 | | EINECS: | | | Product Categories: | | | Mol File: | 2748-40-5.mol |  |
| | N2,N4,N6-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine Chemical Properties |
| Melting point | 254-256 °C | | Boiling point | 639.0±65.0 °C(Predicted) | | density | 1.510±0.06 g/cm3(Predicted) | | pka | 2.13±0.10(Predicted) |
| | N2,N4,N6-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine Usage And Synthesis |
| | N2,N4,N6-tris(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine Preparation Products And Raw materials |
|