| Company Name: |
Suzhou yacoo science co.,Ltd
|
| Tel: |
0512-87182056 18013166090 |
| Email: |
lingling.qi@yacoo.com.cn |
| Products Intro: |
Product Name:4,5-difluoro-1,3-dioxolan-2-one
CAS:171730-81-7
Purity:99% Package:10g;50g;1kg;5Kg;25kg;
|
1,3-Dioxolan-2-one, 4,5-difluoro- manufacturers
|
| | 1,3-Dioxolan-2-one, 4,5-difluoro- Basic information |
| Product Name: | 1,3-Dioxolan-2-one, 4,5-difluoro- | | Synonyms: | 1,3-Dioxolan-2-one, 4,5-difluoro-;4,5-difluoro-1,3-dioxolan-2-one;1,3-Dioxolan-4,5-difluoro-2-one | | CAS: | 171730-81-7 | | MF: | C3H2F2O3 | | MW: | 124.04 | | EINECS: | | | Product Categories: | | | Mol File: | 171730-81-7.mol |  |
| | 1,3-Dioxolan-2-one, 4,5-difluoro- Chemical Properties |
| Boiling point | 233.8±30.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C3H2F2O3/c4-1-2(5)8-3(6)7-1/h1-2H | | InChIKey | DSMUTQTWFHVVGQ-UHFFFAOYSA-N | | SMILES | O1C(F)C(F)OC1=O |
| | 1,3-Dioxolan-2-one, 4,5-difluoro- Usage And Synthesis |
| Uses | 4,?5-?Difluoro-1,?3-?dioxolan-?2-?one (DFEC) is reported as a film forming additive to improve the electrochemical performance of LiNi0.8Co0.15Al0.05O2/[email?protected] full cells. |
| | 1,3-Dioxolan-2-one, 4,5-difluoro- Preparation Products And Raw materials |
|