- CESIUM TUNGSTATE
-
- $0.00 / 25KG
-
2025-07-25
- CAS:13587-19-4
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KGS
- CESIUM TUNGSTATE
-
- $1.00 / 1KG
-
2019-12-24
- CAS:13587-19-4
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10t
|
| | CESIUM TUNGSTATE Basic information |
| Product Name: | CESIUM TUNGSTATE | | Synonyms: | (beta-4)-tungstate(wo42-dicesium;Cesium tungstate, 99.9% trace metals basis;CESIUM TUNGSTATE;CESIUM TUNGSTEN OXIDE;dicesium tungsten tetraoxide;CESIUM TUNGSTATE, 99.95%;CesiumTungstenOxidedispersion;CESIUM TUNGSTATE NANOPARTICLES D50 | | CAS: | 13587-19-4 | | MF: | Cs2O4W | | MW: | 513.65 | | EINECS: | 237-019-0 | | Product Categories: | | | Mol File: | 13587-19-4.mol |  |
| | CESIUM TUNGSTATE Chemical Properties |
| Melting point | >350 °C(lit.) | | form | Powder | | color | White | | Water Solubility | It is soluble in water. | | Sensitive | Hygroscopic | | Exposure limits | ACGIH: TWA 3 mg/m3
NIOSH: TWA 5 mg/m3; STEL 10 mg/m3 | | InChI | InChI=1S/2Cs.4O.W/q2*+1;;;2*-1; | | InChIKey | VPXSRGLTQINCRV-UHFFFAOYSA-N | | SMILES | [W]([O-])([O-])(=O)=O.[Cs+].[Cs+] | | EPA Substance Registry System | Cesium tungsten oxide (Cs2WO4) (13587-19-4) |
| Provider | Language |
|
ALFA
| English |
| | CESIUM TUNGSTATE Usage And Synthesis |
| Uses | Cesium tungsten oxide is used for making transparent insulation coating that has the best infrared transparent barrier feature. |
| | CESIUM TUNGSTATE Preparation Products And Raw materials |
|