|
|
| | 1-METHYL-4-(PIPERIDIN-4-YL)-PIPERAZINE Basic information |
| Product Name: | 1-METHYL-4-(PIPERIDIN-4-YL)-PIPERAZINE | | Synonyms: | TIMTEC-BB SBB010183;4-(1-Methyl-4-piperazinyl)piperidine;Piperazine, 1-methyl-4-(4-piperidinyl)- (9CI);1-Methyl-4-(4-piperidino)piperazine, 98%;1-Methyl-4-(piperidin-4-yl)-piperizine;4-(4-Methylpiperazin-1-yl)piperidine;Piperazine, 1-Methyl-4-(4-piperidinyl)-;1-Methyl-4-(piperidin-4-yl)piperazine.HCl | | CAS: | 53617-36-0 | | MF: | C10H21N3 | | MW: | 183.29 | | EINECS: | | | Product Categories: | PIPERIDINE | | Mol File: | 53617-36-0.mol |  |
| | 1-METHYL-4-(PIPERIDIN-4-YL)-PIPERAZINE Chemical Properties |
| Melting point | 53-56°C | | Boiling point | 261℃ | | density | 0.992 | | Fp | 114℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.27±0.10(Predicted) | | form | solid | | color | Pale yellow | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | InChI | InChI=1S/C10H21N3/c1-12-6-8-13(9-7-12)10-2-4-11-5-3-10/h10-11H,2-9H2,1H3 | | InChIKey | MRYYJGQKVGZGSB-UHFFFAOYSA-N | | SMILES | N1(C)CCN(C2CCNCC2)CC1 | | CAS DataBase Reference | 53617-36-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HazardClass | 8 | | HS Code | 2933399990 |
| | 1-METHYL-4-(PIPERIDIN-4-YL)-PIPERAZINE Usage And Synthesis |
| Uses | It is used both as a reagent and building block in several synthetic applications. As intermediate. As an excellent catalyst for many condensation reactions. |
| | 1-METHYL-4-(PIPERIDIN-4-YL)-PIPERAZINE Preparation Products And Raw materials |
|