| Identification | Back Directory | [Name]
1-BENZYL-5-BROMO-1H-INDOLE | [CAS]
10075-51-1 | [Synonyms]
1-BENZYL-5-BROMOINDOLE Indole, 1-benzyl-5-bromo- 1-BENZYL-5-BROMO-1H-INDOLE 1H-Indole, 5-bromo-1-(phenylmethyl)- | [Molecular Formula]
C15H12BrN | [MDL Number]
MFCD04337704 | [MOL File]
10075-51-1.mol | [Molecular Weight]
286.17 |
| Chemical Properties | Back Directory | [Melting point ]
93-95 °C | [Boiling point ]
425.3±28.0 °C(Predicted) | [density ]
1.35±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C(protect from light) | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
1S/C15H12BrN/c16-14-6-7-15-13(10-14)8-9-17(15)11-12-4-2-1-3-5-12/h1-10H,11H2 | [InChIKey]
AQXJFUYUNHLBGU-UHFFFAOYSA-N | [SMILES]
BrC1=CC=C2C(C=CN2CC3=CC=CC=C3)=C1 |
|
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|