| Identification | Back Directory | [Name]
Ilaprazole Impurity | [CAS]
1018229-53-2 | [Synonyms]
Ilaprazole Impurity 2H-Benzimidazol-2-one, 1,3-dihydro-5-(1H-pyrrol-1-yl)- | [Molecular Formula]
C11H9N3O | [MDL Number]
MFCD34596227 | [MOL File]
1018229-53-2.mol | [Molecular Weight]
199.21 |
| Chemical Properties | Back Directory | [Boiling point ]
255.3±19.0 °C(Predicted) | [density ]
1.40±0.1 g/cm3(Predicted) | [pka]
11.10±0.30(Predicted) | [InChI]
InChI=1S/C11H9N3O/c15-11-12-9-4-3-8(7-10(9)13-11)14-5-1-2-6-14/h1-7H,(H2,12,13,15) | [InChIKey]
QGCWORNUIDJVFR-UHFFFAOYSA-N | [SMILES]
C1(=O)NC2=CC=C(N3C=CC=C3)C=C2N1 |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Roark Standards
|
| Tel: |
0755-83552066 15986688328 |
| Website: |
roarkstandards.com |
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-61855200 13326451905 |
| Website: |
www.toref.cn/ |
|