| Identification | Back Directory | [Name]
17BETA-HYDROXY-4-ANDROSTEN-3-ONE 3-[O-CARBOXYMETHYL]OXIME | [CAS]
10190-93-9 | [Synonyms]
TESTOSTERONE 3-CMO TESTOSTERONE 3-(O-CARBOXYMETHYL)OXIME testosterone 3-0-carboxymethyloxime *--- dea sche 4-Androsten-17β-ol-3-one 3-(O-carboxymethyl)oxime 4-ANDROSTEN-17BETA-OL-3-ONE 3-[O-CARBOXYMETHYL]OXIME 17β-hydroxy-4-androsten-3-one 3-(o-carboxymethyl)oxime 17BETA-HYDROXY-4-ANDROSTEN-3-ONE 3-[O-CARBOXYMETHYL]OXIME 17β-Hydroxy-4-androsten-3-one 3-(O-carboxymethyl)oxime, 4-Androsten-17β-ol-3-one 3-(O-carboxymethyl)oxime | [Molecular Formula]
C21H31NO4 | [MDL Number]
MFCD00056503 | [MOL File]
10190-93-9.mol | [Molecular Weight]
361.48 |
| Chemical Properties | Back Directory | [Melting point ]
179-181 °C | [Boiling point ]
526.8±60.0 °C(Predicted) | [density ]
1.34±0.1 g/cm3(Predicted) | [storage temp. ]
room temp | [solubility ]
ethanol: soluble49-51mg/mL, clear, colorless to faintly yellow | [form ]
powder | [pka]
3.15±0.10(Predicted) | [InChIKey]
VDYLVWGBLQNNAW-MIQUVITGNA-N | [SMILES]
[C@@]12([H])CCC3=C/C(=N\OCC(=O)O)/CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])O |&1:0,15,17,21,23,26,r| |
| Hazard Information | Back Directory | [Uses]
Testosterone 3-(O-carboxymethyl)oxime has been used to prepare horseradish peroxidase (HRP)-labeled testosterone to measure plasma testosterone concentration by enzyme immunoassay. | [Biochem/physiol Actions]
Androgens direct the development of male reproductive system and secondary sexual characteristics. Testosterone is an androgen that is secreted by the testis. This hormone is converted to dihydrotestosterone (DHT) by 5α reductase in the target tissues. Both DHT and testosterone require androgen receptor, a ligand-dependent nuclear transcription factor to mediate their biological functions. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Biosynth Ltd
|
| Tel: |
18886812933 |
| Website: |
www.biosynth.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Steraloids Inc.
|
| Tel: |
401 848-5422 |
| Website: |
http://www.steraloids.com |
| Company Name: |
Research Plus, Inc.
|
| Tel: |
800 341-2296 (U.S. and Canada) |
| Website: |
www.researchplus.com |
|