| Identification | Back Directory | [Name]
3,6-BIS(DIETHYLAMINO)-9-[2-(4-METHYLCOUMARIN-7-YLOXYCARBONYL)PHENYL]XANTHYLIUM CHLORIDE | [CAS]
1021902-10-2 | [Synonyms]
MITO RED RHODAMINE B 4-METHYLUMBELLIFERYL ESTER CHLORIDE Mito Red suitable for fluorescence, >=70% (HPLC) 3,6-BIS(DIETHYLAMINO)-9-[2-(4-METHYLCOUMARIN-7-YLOXYCARBONYL)PHENYL]XANTHYLIUM CHLORIDE Rhodamine B 4-methylumbelliferyl ester chloride, 3,6-Bis(diethylamino)-9-[2-(4-methylcoumarin-7-yloxycarbonyl)phenyl]xanthylium chloride | [Molecular Formula]
C38H37ClN2O5 | [MDL Number]
MFCD05664720 | [MOL File]
1021902-10-2.mol | [Molecular Weight]
637.16 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [form ]
solid | [InChIKey]
XCVSDCPWJRHMSZ-UHFFFAOYSA-M | [SMILES]
[Cl-].CCN(CC)c1ccc2c(-c3ccccc3C(=O)Oc4ccc5C(C)=CC(=O)Oc5c4)c6ccc(cc6[o+]c2c1)N(CC)CC |
| Hazard Information | Back Directory | [Uses]
Mito Red is a cell membrane permeable rhodamine based dye. It localizes mitochondria, and emits red fluorescence. The interaction of Mito Red with mitochondria depends on the membrane potential of the mitochondria. Mitochondria can be stained with 20-200 nM of Mito Red. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|