| Identification | Back Directory | [Name]
A[5']P4[5']A AMMONIUM SALT | [CAS]
102783-36-8 | [Synonyms]
moniumsalt a(5')p4(5')a A[5']P4[5']A AMMONIUM SALT Fludarabine Phosphate Impurity 33 P1,P4-Di(adenosine-5′) tetraphosphate DIADENOSINE TETRAPHOSPHATE AMMONIUM SALT P1,P4-DI(ADENOSINE-5')TETRAPHOSPHATEAMMO NIUM P1,P4-DI(ADENOSINE-5') TETRAPHOSPHATE AMMONIUM SALT diadenosine5’,5’’’-p(sup1),p(sup4)-tetraphosphatetetraammoniumsalt 5’-(pentahydrogentetraphosphate)adenosine5’-5’-esterwithadenosinetetraam adenosine,5’-(pentahydrogentetraphosphate),5’,5’-esterwithadenosine,tetra | [Molecular Formula]
C20H31N11O19P4 | [MDL Number]
MFCD00058622 | [MOL File]
102783-36-8.mol | [Molecular Weight]
853.42 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
H2O: 50 mg/mL | [form ]
powder | [color ]
white | [Water Solubility ]
H2O: 50mg/mL | [InChIKey]
JTLRVYSRZSPJKJ-AHKIGRPSSA-N | [SMILES]
N.Nc1ncnc2n(cnc12)[C@@H]3O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)n5cnc6c(N)ncnc56)[C@@H](O)[C@H]3O |
| Hazard Information | Back Directory | [Uses]
P1,P4-Di(adenosine-5’) Tetraphosphate Ammonium Salt is a derivative of Diadenosine polyphosphate, which is stored in secretory granules of thrombocytes. | [Uses]
P1,P4-Di(adenosine-5′) tetraphosphate ammonium salt has been used as a substrate for nudix hydrolyse. It has also been used as a ATP analog and nudix substrate for cleavage factor II Im25 subunit. | [Biochem/physiol Actions]
Diadenosine polyphosphate (Ap4A) functions as a second messenger in pancreatic cells. Diadenosine polyphosphate is majorly stored in neuronal cells, thrombocytes and chromaffin. It stimulates phospholipase D, fluctuates intracellular calcium levels, induces nitric oxide release, activates 5′-nucleotidase, and inhibits adenosine kinase activity?in vitro. The membrane-bound ectoenzymes in endothelial cells in blood plasma and smooth muscle cell metabolize Ap4A. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|