| Identification | Back Directory | [Name]
3-Methoxynaphthalene-2-boronic acid | [CAS]
104115-76-6 | [Synonyms]
3-Methoxy-2-naphthylboronic acid 3-methoxynaphthalen-2-boronic acid 3-methoxy-2-naphthaleneboronic acid 2-Methoxy-3-naphthaleneboronic acid 3-Methoxynaphthalene-2-boronic acid 3-methoxynaphthalen-2-yl-2-boronic acid 3-Methoxynaphthalene-2-boronic acid 98% Boronic acid, (3-methoxy-2-naphthalenyl)- 3-Methoxynaphthalen-2-yl-2-ylboronic acid Boronic acid, B-(3-methoxy-2-naphthalenyl)- 3-METHOXY-2-NAPHTHYLBORONIC ACID; 2-METHOXY-3-NAPHTHALENEBORONIC ACID; 3-METHOXYNAPHTHALENE-2-BORONIC ACID | [Molecular Formula]
C11H11BO3 | [MDL Number]
MFCD12025968 | [MOL File]
104115-76-6.mol | [Molecular Weight]
202.01 |
| Chemical Properties | Back Directory | [Melting point ]
153-155 °C | [Boiling point ]
425.2±47.0 °C(Predicted) | [density ]
1.23±0.1 g/cm3(Predicted) | [storage temp. ]
Inert atmosphere,2-8°C | [form ]
crystals | [pka]
8.53±0.30(Predicted) | [color ]
Off-white | [InChI]
InChI=1S/C11H11BO3/c1-15-11-7-9-5-3-2-4-8(9)6-10(11)12(13)14/h2-7,13-14H,1H3 | [InChIKey]
RHNSMLZROCLQBJ-UHFFFAOYSA-N | [SMILES]
B(C1=C(OC)C=C2C(=C1)C=CC=C2)(O)O |
| Hazard Information | Back Directory | [Uses]
3-Methoxynaphthalene-2-boronic acid can be used as organic synthesis intermediates and pharmaceutical intermediates, which are mainly used in laboratory research and development process and chemical production process. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|