| Identification | Back Directory | [Name]
4-PHENYL-2-BUTYL ACETATE | [CAS]
10415-88-0 | [Synonyms]
4-PHENYL-2-BUTYL ACETATE 4-phenylbut-2-yl acetate CH3C(O)OCH(CH3)CH2CH2C6H5 4-Phenyl-2-butanol acetate 4-PHENYL-2-BUTYL ACETATE 98+% 2-Butanol, 4-phenyl-, acetate 1-METHYL-3-PHENYLPROPYL ACETATE α-Methylbenzene-1-propanol acetate alpha-methyl-benzenepropanoacetate Phenylpropanol, alpha-methyl, acetate Acetic acid 1-benzylpropane-2-yl ester Benzenepropanol, alpha-methyl-, acetate Benzenepropanol,.alpha.-methyl-,acetate | [EINECS(EC#)]
233-890-6 | [Molecular Formula]
C12H16O2 | [MDL Number]
MFCD00026203 | [MOL File]
10415-88-0.mol | [Molecular Weight]
192.25 |
| Hazard Information | Back Directory | [Chemical Properties]
4-Phenyl-2-butyl acetate has a mild, green, fruity odor and a sweet, fruity taste. | [Definition]
ChEBI: 4-Phenyl-2-butyl acetate is a member of benzenes. | [Preparation]
By acetylation of the corresponding alcohol; the racemic and the dextrorotatory forms are known. |
|
| Company Name: |
jiliang chemicals
|
| Tel: |
21-62165282 15801962796; |
| Website: |
http://www.jiliangchem.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
+1 (201) 478-8534 |
| Website: |
www.alfa-chemistry.com |
| Company Name: |
Acros Organics
|
| Tel: |
+32 14/57.52.11 |
| Website: |
www.acros.be |
|