| Identification | Back Directory | [Name]
(1S, 2S)-1,2-di-1-Naphthyl-ethylenediaMine dihydrochloride | [CAS]
1052707-27-3 | [Synonyms]
(1S, 2S)-1,2-di-1-Naphthyl-ethylenediaMine dihydrochloride 97%
(1S,2S)-1,2-Di(naphthalen-1-yl)ethane-1,2-diamine dihydrochloride
(1S,2S)-1,2-Di-1-naphthalenyl-1,2-ethanediamine hydrochloride (1:2) | [Molecular Formula]
C22H22Cl2N2 | [MDL Number]
MFCD09836226 | [MOL File]
1052707-27-3.mol | [Molecular Weight]
385.329 |
| Chemical Properties | Back Directory | [Melting point ]
219-224°C | [form ]
powder | [Optical Rotation]
[α]22/D +258.0°, c = 1 in H2O | [InChI]
1S/C22H20N2.2ClH/c23-21(19-13-5-9-15-7-1-3-11-17(15)19)22(24)20-14-6-10-16-8-2-4-12-18(16)20;;/h1-14,21-22H,23-24H2;2*1H/t21-,22-;;/m0../s1 | [InChIKey]
SHNGCXWOHADIKG-IXOXMDGESA-N | [SMILES]
Cl[H].Cl[H].N[C@H]([C@@H](N)c1cccc2ccccc12)c3cccc4ccccc34 |
| Hazard Information | Back Directory | [Uses]
(1S, 2S)-1,2-di-1-Naphthyl-ethylenediamine dihydrochloride can be used to synthesize N,N′-[(1S,2S)-1,2-di-1-naphthyl-ethylene]bis2-propenamide, a chiral monomer, to prepare polymeric chiral stationary phase for HPLC. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
NE Scientific
|
| Tel: |
+1 (617) 651-6662 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19253/0_EN.htm |
|