| Identification | Back Directory | [Name]
1-(3'-FLUORO-4'-METHOXYPHENYL)ETHYLAMINE | [CAS]
105321-49-1 | [Synonyms]
Albb-004960 1-(3-FLUORO-4-METHOXYPHENYL)ETHANAMINE 1-(3'-FLUORO-4'-METHOXYPHENYL)ETHYLAMINE 1-(3-FLUORO-4-METHOXY-PHENYL)-ETHYLAMINE 1-(3-Fluoro-4-methoxyphenyl)ethan-1-amine Benzenemethanamine,3-fluoro-4-methoxy-a-methyl- Benzenemethanamine, 3-fluoro-4-methoxy-α-methyl- 1-(3-fluoro-4-methoxyphenyl)ethanamine(SALTDATA: FREE) | [Molecular Formula]
C9H12FNO | [MDL Number]
MFCD04116349 | [MOL File]
105321-49-1.mol | [Molecular Weight]
169.2 |
| Chemical Properties | Back Directory | [Boiling point ]
244.3±30.0 °C(Predicted) | [density ]
1.092±0.06 g/cm3(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [pka]
8.97±0.10(Predicted) | [Appearance]
Colorless to light yellow Liquid | [InChI]
InChI=1S/C9H12FNO/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-6H,11H2,1-2H3 | [InChIKey]
WGUPBBABCUKYCC-UHFFFAOYSA-N | [SMILES]
C1(F)C(OC)=CC=C(C(C)N)C=1 |
| Hazard Information | Back Directory | [Uses]
1-(3-Fluoro-4-methoxyphenyl)ethanamine is a useful compound in preparation of heteroaryl-fused pyridines as orexin receptor inhibitors. |
|
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|