| Identification | Back Directory | [Name]
2-ethyl-4-methylpentan-1-ol | [CAS]
106-67-2 | [Synonyms]
1-Pentanol, 2-ethyl-4-methyl- 2-Ethyl-4-methyl-1-pentanol 2 | [EINECS(EC#)]
203-422-5 | [Molecular Formula]
C8H18O | [MDL Number]
MFCD01709207 | [MOL File]
106-67-2.mol | [Molecular Weight]
130.23 |
| Chemical Properties | Back Directory | [Melting point ]
-61.15°C (estimate) | [Boiling point ]
176.5°C | [density ]
0.8260 | [refractive index ]
1.4270 | [storage temp. ]
Sealed in dry,Room Temperature | [solubility ]
Chloroform (Soluble), Methanol (Soluble) | [form ]
Oil | [pka]
15.05±0.10(Predicted) | [color ]
Colourless | [InChI]
InChI=1S/C8H18O/c1-4-8(6-9)5-7(2)3/h7-9H,4-6H2,1-3H3 | [InChIKey]
QCHSJPKDWOFACC-UHFFFAOYSA-N | [SMILES]
C(O)C(CC)CC(C)C | [LogP]
1.812 (est) | [EPA Substance Registry System]
1-Pentanol, 2-ethyl-4-methyl- (106-67-2) |
| Hazard Information | Back Directory | [Uses]
2-Ethyl-4-methyl-1-pentanol is a volatile chemical that can be used to diagnose ratoon stunting disease in Sugar cane. | [Definition]
ChEBI: 2-Ethyl-4-methyl-1-pentanol is a primary alcohol. |
|
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
|