| Identification | Back Directory | [Name]
4-DMSVBCB | [CAS]
1066880-14-5 | [Synonyms]
4-DMSVBCB 4-DMVSBCB Bicyclo[4.2.0]octa-1,3,5-triene, 3-(ethenyldimethylsilyl)- | [Molecular Formula]
C12H16Si | [MOL File]
1066880-14-5.mol | [Molecular Weight]
188.35 |
| Chemical Properties | Back Directory | [Boiling point ]
242.5±29.0 °C(Predicted) | [density ]
0.94±0.1 g/cm3(Predicted) | [InChI]
InChI=1S/C12H16Si/c1-4-13(2,3)12-8-7-10-5-6-11(10)9-12/h4,7-9H,1,5-6H2,2-3H3 | [InChIKey]
PYEQCUVKXSZRIO-UHFFFAOYSA-N | [SMILES]
[Si](C1=CC=C2CCC2=C1)(C)(C)C=C |
| Hazard Information | Back Directory | [Uses]
4-DMSVBCB is mainly used as an intermediate in electronic materials, for the synthesis of low dielectric constant materials, packaging materials and polymerization stabilizers. | [General Description]
4-DMSVBCB (full name: 1-Dimethylvinylsilylbenzocyclobutene) is a high-purity (99%) organosilicon compound that can be used as a pharmaceutical intermediate. |
|
| Company Name: |
baiyinyuyuehui
|
| Tel: |
+86-18809439555 +86-13262587081 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1677720/0.htm |
|