| Identification | Back Directory | [Name]
(DIMETHYLAMINOMETHYLENE)DIMETHYLAMMONIUM CHLORIDE | [CAS]
1071-38-1 | [Synonyms]
BIS(DIMETHYLAMINO)CARBENIUM CHLORIDE N,N,N',N'-TETRAMETHYLFORMAMIDINIUM CHLORIDE (DIMETHYLAMINOMETHYLENE)DIMETHYLAMMONIUM CHLORIDE N,N,N',N'-Tetramethylformamidiniumchloridepurum(at) (Dimethylaminomethylene)dimethylammonium chloride 97% | [Molecular Formula]
C5H13ClN2 | [MDL Number]
MFCD00192067 | [MOL File]
1071-38-1.mol | [Molecular Weight]
136.62 |
| Chemical Properties | Back Directory | [Melting point ]
130-139 °C (lit.) | [storage temp. ]
2-8°C | [InChI]
1S/C5H13N2.ClH/c1-6(2)5-7(3)4;/h5H,1-4H3;1H/q+1;/p-1 | [InChIKey]
BPBLGCSAYMJJJW-UHFFFAOYSA-M | [SMILES]
[Cl-].[H]\C(N(C)C)=[N+](\C)C |
| Hazard Information | Back Directory | [Uses]
(Dimethylaminomethylene)dimethylammonium chloride (N,N,N′,N′-tetramethylformamidinium chloride) may be used in the synthesis of the following:
- aminomethylene hydantoins
- thiohydantoins
- 2,2′-o-phenyl-enebis(1,3-di-meth-ylguanidine)
- N,N-dimethylformamide di-tert-butyl acetal
| [General Description]
(Dimethylaminomethylene)dimethylammonium chloride is an amidine derivative. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|