| Identification | Back Directory | [Name]
2-HEPTYL-3-HYDROXY-4-QUINOLONE | [CAS]
108985-27-9 | [Synonyms]
PQS 2-HEPTYL-3-HYDROXY-4-QUINOLONE 2-Heptyl-3-hydroxyl-4-quinolone 2-Heptyl-3-hydroxy-4(1H)-quinolone 2-Heptyl-3-hydroxy-4(1H)-quinolinone 2-heptyl-3-hydroxyquinolin-4(1H)-one 2-heptyl-3-hydroxy-1H-quinolin-4-one 2-heptyl-3-hydroxy-3H-quinolin-4-one 3,4-Dihydroxy-2-heptylquinoline, 97+% 4(1H)-Quinolinone, 2-heptyl-3-hydroxy- 2-heptyl-3-hydroxy-3,4-dihydroquinolin-4-one 2-Heptyl-3-hydroxy-4(1H)-quinolone >=96.0% (HPLC) | [Molecular Formula]
C16H21NO2 | [MDL Number]
MFCD07437949 | [MOL File]
108985-27-9.mol | [Molecular Weight]
259.34 |
| Chemical Properties | Back Directory | [Melting point ]
182-185℃ | [Boiling point ]
389.4±42.0 °C(Predicted) | [density ]
1.102 | [storage temp. ]
-20°C | [solubility ]
Methanol: soluble | [form ]
A solid | [pka]
11.00±0.20(Predicted) | [color ]
White to light brown | [InChI]
1S/C16H21NO2/c1-2-3-4-5-6-11-14-16(19)15(18)12-9-7-8-10-13(12)17-14/h7-10,19H,2-6,11H2,1H3,(H,17,18) | [InChIKey]
CEIUIHOQDSVZJQ-UHFFFAOYSA-N | [SMILES]
CCCCCCCC1=C(O)C(=O)c2ccccc2N1 |
| Hazard Information | Back Directory | [Uses]
Quorum sensing is a signaling system used by bacteria to coordinate activity based upon their population density. The system involves the exchange of signaling molecules among bacteria via cell receptors. Heptyl-3-hydroxy-4(1H)-quinolone (PQS) is a quorum sensing-regulated virulence factor used to induce and study the regulation of virulence genes such as those involved in iron scavenging. | [General Description]
2-heptyl-3-hydroxy-4-quinolone can function as an intercellular signal. |
|
| Company Name: |
VladaChem GmbH
|
| Tel: |
+49-7246-3082843 |
| Website: |
https://www.vladachem.com/search.php |
|