| Identification | Back Directory | [Name]
4,4'-BIS[2-(1-PROPENYL)PHENOXY]BENZOPHENONE | [CAS]
109423-33-8 | [Synonyms]
4,4'-BIS[2-(1-PROPENYL)PHENOXY]BENZOPHENONE bis[4-(2-prop-1-enylphenoxy)phenyl]methanone bis[4-[2-(1-propenyl)phenoxy]phenyl]-methanon Methanone, bis(4-(2-(1-propenyl)phenoxy)phenyl)- Methanone, bis(4-(2-(1-propen-1-yl)phenoxy)phenyl)- 4,4-Bis[2-(1-propenyl)phenoxy]benzophenone,mixture of cis and trans 4,4'-Bis[2-(1-propenyl)phenoxy]benzophenone, mixture of cis and trans 97% 4,4'-BIS(2-(1-PROPENYL)PHENOXY)BENZO-PHE NONE, 97%, MIXTURE OF CIS AND TRANS | [Molecular Formula]
C31H26O3 | [MDL Number]
MFCD00216597 | [MOL File]
109423-33-8.mol | [Molecular Weight]
446.54 |
| Chemical Properties | Back Directory | [Melting point ]
43-45 °C(lit.) | [Boiling point ]
576.6±50.0 °C(Predicted) | [density ]
1.143±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [InChI]
1S/C31H26O3/c1-3-9-23-11-5-7-13-29(23)33-27-19-15-25(16-20-27)31(32)26-17-21-28(22-18-26)34-30-14-8-6-12-24(30)10-4-2/h3-22H,1-2H3/b9-3+,10-4+ | [InChIKey]
JRZSSQRNBKDVDD-LQIBPGRFSA-N | [SMILES]
C\C=C\c1ccccc1Oc2ccc(cc2)C(=O)c3ccc(Oc4ccccc4\C=C\C)cc3 | [EPA Substance Registry System]
Methanone, bis[4-[2-(1-propenyl)phenoxy]phenyl]- (109423-33-8) |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|