| Identification | Back Directory | [Name]
L-4-HYDROXYPHENYL(ALANINE-2-13C) | [CAS]
110622-46-3 | [Synonyms]
L-TYROSINE (2-13C) L-TYROSINE-ALPHA-13C L-TYROSINE-CARBOXY-13C L-4-HYDROXYPHENYL(ALANINE-2-13C) 4-hydroxyphenylalanine-carboxy-13c L-TYROSINE-CARBOXY-13C, 99 ATOM % 13C L-Tyrosine-1-13C >=99 atom % 13C, >=98% (CP) | [Molecular Formula]
C9H11NO3 | [MDL Number]
MFCD00083988 | [MOL File]
110622-46-3.mol | [Molecular Weight]
182.2 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C (dec.)(lit.) | [form ]
Solid | [color ]
White to off-white | [Optical Rotation]
[α]20/D -10.6°, c = 4 in 1 M HCl | [InChI]
1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i8+1,10+1 | [InChIKey]
OUYCCCASQSFEME-OIWRJEPOSA-N | [SMILES]
OC1=CC=C(C[13C@H]([15NH2])C(O)=O)C=C1 | [CAS Number Unlabeled]
60-18-4 |
| Hazard Information | Back Directory | [Uses]
L-Tyrosine-13C is the 13C-labeled L-Tyrosine. L-Tyrosine is a non-essential amino acid which can inhibit citrate synthase activity in the posterior cortex. | [References]
[1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Medical Isotopes
|
| Tel: |
1-(603) 635-1722 |
| Website: |
www.medicalisotopes.com |
|