| Identification | Back Directory | [Name]
2,5-dimethoxyterephthalohydrazide | [CAS]
114503-42-3 | [Synonyms]
2,5-dimethoxyterephthalohydrazide 1,4-Benzenedicarboxylic acid, 2,5-dimethoxy-, 1,4-dihydrazide | [Molecular Formula]
C10H14N4O4 | [MDL Number]
MFCD34165571 | [MOL File]
114503-42-3.mol | [Molecular Weight]
254.24 |
| Chemical Properties | Back Directory | [density ]
1.320±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light | [pka]
11.18±0.10(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C10H14N4O4/c1-17-7-3-6(10(16)14-12)8(18-2)4-5(7)9(15)13-11/h3-4H,11-12H2,1-2H3,(H,13,15)(H,14,16) | [InChIKey]
LMKFGEOWEBMUDY-UHFFFAOYSA-N | [SMILES]
C(NN)(=O)C1=CC(OC)=C(C(NN)=O)C=C1OC |
| Hazard Information | Back Directory | [Uses]
2,5-Dimethoxyterephthalohydrazide is used as a monomer for the synthesis of COF materials: COF-JLU4; TFB-DMTHCOF; Tf-DHzOMe. |
|
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
|