| Identification | Back Directory | [Name]
1-DODECYL-3-METHYLIMIDAZOLIUM CHLORIDE | [CAS]
114569-84-5 | [Synonyms]
C12MIMCl 1-Dodecyl-3-methyimidazolium Chloride 1-DODECYL-3-METHYLIMIDAZOLIUM CHLORIDE 1-Dodecyl-3-methylimidazolium chloride 97+% | [EINECS(EC#)]
200-145-6 | [Molecular Formula]
C16H31ClN2 | [MDL Number]
MFCD03427606 | [MOL File]
114569-84-5.mol | [Molecular Weight]
286.88 |
| Chemical Properties | Back Directory | [Appearance]
white to yellow powder and chunks | [Melting point ]
96.63 °C | [storage temp. ]
Inert atmosphere,Room Temperature | [InChI]
InChI=1S/C16H31N2.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;/h14-16H,3-13H2,1-2H3;1H/q+1;/p-1 | [InChIKey]
OPXNHKQUEXEWAM-UHFFFAOYSA-M | [SMILES]
N1(CCCCCCCCCCCC)C=C[N+](C)=C1.[Cl-] | [CAS DataBase Reference]
114569-84-5 |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
3A Chemicals
|
| Telephone: |
400-668-9898 |
| Website: |
www.3achem.com |
|