| Identification | Back Directory | [Name]
Pd-PEPPSI-IPent catalyst | [CAS]
1158652-41-5 | [Synonyms]
Pd-PEPPSI-IPent Pd-PEPPSI-IHeptCl 3-ClPy [1,3-Bis(2,6-Di-3-pentyL Pd-PEPPSI?-IPent catalyst PD-PEPPSI(TM)-IPENT CATALYST Pd-PEPPSI(TM)-IPent catalyst >=95% [1,3-Bis(2,6-Di-3-pentylphenyl)imidazol-2-ylidene](3-chloropyridyl)dichloropalladium(II) Dichloro[1,3-bis(2,6-Di-3-pentylphenyl)imidazol-2-ylidene](3-chloropyridyl)palladium(II) [1,3-Bis(2,6-Di-3-pentylphenyl)imidazol-2-ylidene](3-chloropyridyl)palladium(II) dichloride Pd-PEPPSI-IPent catalyst / Dichloro[1,3-bis(2,6-Di-3-pentylphenyl)imidazol-2-ylidene](3-chloropyridyl)palladium(II) | [Molecular Formula]
C40H56Cl3N3Pd | [MDL Number]
MFCD34166665 | [MOL File]
1158652-41-5.mol | [Molecular Weight]
791.68 |
| Chemical Properties | Back Directory | [Melting point ]
195-201°C | [storage temp. ]
-20°C | [form ]
solid | [InChIKey]
RMLKULBPXAMLKU-UHFFFAOYSA-L | [SMILES]
[Pd+4](N1=CC=CC(Cl)=C1)(=[C-2]1N(C2C(=CC=CC=2C(CC)CC)C(CC)CC)C=CN1C1C(=CC=CC=1C(CC)CC)C(CC)CC)([Cl-])[Cl-] |
| Hazard Information | Back Directory | [Uses]
- Catalyst for Stille coupling reaction (eq. 1)
- Catalyst for Negishi coupling reaction (eq. 2)
- Catalyst for Suzuki coupling reaction (eq. 3)
![]() | [Uses]
Pd-PEPPSI(TM)-IPent catalyst can be used in Stille coupling reaction , Negishi coupling reaction and Suzuki coupling reaction TM -IPent used in cross coupling reaction.
| [reaction suitability]
reagent type: catalyst reaction type: Cross Couplings |
|
| Company Name: |
ChemicalRIM Co., Ltd Gold
|
| Tel: |
15184345951 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList988301/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|