| Identification | Back Directory | [Name]
ap-dCTP | [CAS]
115899-39-3 | [Synonyms]
ap-dCTP ap-dCTP·3TEA 5-Propargylamino-dCTP 5-Propargylamino-dCTP - solution 5-(3-Amino-1-propyn-1-yl)-2'-deoxycytidine 5'-(tetrahydrogen triphosphate) Cytidine 5'-(tetrahydrogen triphosphate), 5-(3-amino-1-propyn-1-yl)-2'-deoxy- | [Molecular Formula]
C12H19N4O13P3 | [MDL Number]
MFCD28010326 | [MOL File]
115899-39-3.mol | [Molecular Weight]
520.22 |
| Chemical Properties | Back Directory | [Boiling point ]
836.0±75.0 °C(Predicted) | [density ]
2.16±0.1 g/cm3(Predicted) | [form ]
Solid | [pka]
0.97±0.50(Predicted) | [color ]
White to off-white | [InChIKey]
LVTQIVFSMGDIPF-IVZWLZJFSA-N | [SMILES]
C(OP(=O)(O)OP(O)(=O)OP(O)(O)=O)[C@H]1O[C@@H](N2C=C(C#CCN)C(N)=NC2=O)C[C@@H]1O |
| Hazard Information | Back Directory | [Description]
5-Propargylamino-dCTP is a nucleoside molecule extracted from patent US9035035B2, compound dCTP-PA. 5-Propargylamino-dCTP can conjugate to molecular markers for use in nucleic acid labeling or sequence analysis. 5-Propargylamino-dCTP is a click chemistry reagent, itcontains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | [Uses]
5-Propargylamino-dCTP is a nucleoside molecule extracted from patent US9035035B2, compound dCTP-PA. 5-Propargylamino-dCTP can conjugate to molecular markers for use in nucleic acid labeling or sequence analysis[1]. 5-Propargylamino-dCTP is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | [References]
[1] Cherkasov D, et, al. Macromolecular nucleotide compounds and methods for using the same. US9035035B2. |
|
| Company Name: |
BePharm Ltd
|
| Tel: |
400-685-9117 |
| Website: |
www.bepharm.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
|