| Identification | Back Directory | [Name]
(R)-ALPHA-CYANOBENZYL ACETATE | [CAS]
119718-89-7 | [Synonyms]
D-MANDELONITRILE ACETATE (r)-α-cyanobenzyl acetate O-ACETYL-D-MANDELONITRILE (R)-ALPHA-CYANOBENZYL ACETATE (R)-ALPHA-ACETOXYPHENYLACETONITRILE (R)-(+)-ALPHA-ACETOXYPHENYLACETONITRILE Benzeneacetonitrile, α-(acetyloxy)-, (αR)- (R)-α-Cyanobenzyl acetate, O-Acetyl-D-mandelonitrile | [Molecular Formula]
C10H9NO2 | [MDL Number]
MFCD00191699 | [MOL File]
119718-89-7.mol | [Molecular Weight]
175.18 |
| Chemical Properties | Back Directory | [Boiling point ]
268 °C(lit.) | [density ]
1.115 g/mL at 25 °C(lit.) | [refractive index ]
n20/D 1.506 | [Fp ]
>230 °F | [Optical Rotation]
[α]20/D +8.0±0.5°, c =10% in chloroform | [InChI]
1S/C10H9NO2/c1-8(12)13-10(7-11)9-5-3-2-4-6-9/h2-6,10H,1H3/t10-/m0/s1 | [InChIKey]
MUXDFYRMYMEGCM-JTQLQIEISA-N | [SMILES]
CC(=O)O[C@@H](C#N)c1ccccc1 |
| Hazard Information | Back Directory | [Uses]
(R)-α-Acetoxyphenylacetonitrile can be used as a model compound in the iodine promoted as well as t-BuONO-assisted secondary amides synthesis via an aryl?N-addition reaction to the -CN group of nitriles. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Interchim S.A.
|
| Tel: |
(33) 4 70 03 88 55 |
| Website: |
www.interchim.com |
|