| Identification | Back Directory | [Name]
L-LYSINE 2HCL (U-13C6, 15N2) | [CAS]
1200447-00-2 | [Synonyms]
13C and 15N Labeled Lys "L-Lysine-13C6,15N2.HCl" L-LYSINE 2HCL (U-13C6, 15N2) L-LYSINE-13C6,15N2 HYDROCHLORIDE L-Lysine-13C?,1?N? hydrochloride 13C and 15N Labeled lysine hydrochloride (S)-2,6-Diaminohexanoic acid-13C6,15N2 hydrochloride L-Lysine-13C6,15N2 hydrochloride 99 atom % 13C, 99 atom % 15N, 95% (CP) | [Molecular Formula]
C6H15ClN2O2 | [MDL Number]
MFCD00144647 | [MOL File]
1200447-00-2.mol | [Molecular Weight]
190.72 |
| Chemical Properties | Back Directory | [Melting point ]
263-264 °C (dec. )(lit.) | [storage temp. ]
Hygroscopic, Refrigerator, under inert atmosphere | [solubility ]
Aqueous Acid (Slightly, Sonicated), Water (Slightly) | [form ]
Solid | [color ]
White to Off-White | [Optical Rotation]
[α]25/D +20.7°, c = 2 in 5 M HCl | [InChI]
1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1; | [InChIKey]
BVHLGVCQOALMSV-GSMNGUNQSA-N | [SMILES]
Cl.[15NH2][13CH2][13CH2][13CH2][13CH2][13C@H]([15NH2])[13C](O)=O |
| Hazard Information | Back Directory | [Uses]
Pulsed Stable Isotope labeling of amino acid has been used to study host-cell function, survival, the precise intracellular pathways in protein synthesis of HIV-1 infected human monocytederived macrophages. | [General Description]
Lysine is a basic ketogenic amino acid with a protonated alkyl amino group. Lysine degradation results in the formation of acetoacetate. Acetylation/deacetylation of lysine residues in histones is a mechanism to regulate chromatin organization in eukaryotes. Isotope labeled amino acids are required for the production of isotopically labeled proteins. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Website: |
www.enzo.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carl Roth offre
|
| Tel: |
03.88.94.82.42 |
| Website: |
www.carlroth.com |
|