| Identification | Back Directory | [Name]
(1R,2R)-(-)-1,2-DICYCLOHEXYL-1,2-ETHANEDIOL | [CAS]
120850-92-2 | [Synonyms]
(1r,2r)-1,2-dicyclohexylethylene glycol (R,R)-(-)-1,2-DICYCLOHEXYL-1,2-ETHANEDIOL (1R,2R)-(-)-1,2-DICYCLOHEXYL-1,2-ETHANEDIOL (1R,2R)-1,2-Dicyclohexyl-1,2-ethanediol 95% (R,R)-(-)-1,2-Dicyclohexyl-1,2-ethanediol,99% | [Molecular Formula]
C14H26O2 | [MDL Number]
MFCD00145236 | [MOL File]
120850-92-2.mol | [Molecular Weight]
226.36 |
| Chemical Properties | Back Directory | [Appearance]
white fluffy fine needles | [Melting point ]
138-142 °C(lit.)
| [Boiling point ]
327.98°C (rough estimate) | [density ]
0.9538 (rough estimate) | [refractive index ]
1.4780 (estimate) | [pka]
14.24±0.20(Predicted) | [Optical Rotation]
[α]20/D 2.2°, c = 0.8 in chloroform | [InChI]
1S/C14H26O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h11-16H,1-10H2/t13-,14-/m1/s1 | [InChIKey]
CKHLARJSOMXDKL-ZIAGYGMSSA-N | [SMILES]
O[C@H](C1CCCCC1)[C@H](O)C2CCCCC2 |
| Hazard Information | Back Directory | [Chemical Properties]
white fluffy fine needles | [Uses]
C2 symmetric chiral diol with versatile applications as a chiral auxiliary, building block, and chiral ligand. Chiral auxiliary for preparing highly diastereomerically pure alkyl boronates. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|