| Identification | Back Directory | [Name]
α-Desmethyl Anastrozole | [CAS]
1215780-15-6 | [Synonyms]
Anastrozole α-DesMethyl α-Desmethyl Anastrozole α-Desmethyl Anastrozole Anastrozole EP Impurity A Anastrozole Impurity 6(EP Impurity A) Anastrozole Impurity 6(Anastrozole EP Impurity A) α1,α1,α3-TriMethyl-5-(1H-1,2,4-triazol-1-ylMethyl)- 1,3-Benzenediacetonitrile, α1,α1,α3-trimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)- 2-[3-(1-Cyanoethyl)-5-(1H,1,2,4-triazole-1-ylMethyl)phenyl]-2-Methylpropionitrile 2-[3-(1-cyano-ethyl)-5-(1H-1,2,4-triazol-1-ylmethyl)phenyl]-2-methyl-propionitrile Anastrozole EP Impurity A/ Anastrozole Related Compound B (α-Desmethyl Anastrozole) 2-[3-(1-cyanoethyl)-5-[(1H-1,2,4-triazol-1-yl)methyl]
phenyl]-2-methylpropanenitrile 2-[3-[(1RS)-1-Cyanoethyl]-5-(1H-1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile Anastrozole EP Impurity AQ: What is
Anastrozole EP Impurity A Q: What is the CAS Number of
Anastrozole EP Impurity A Q: What is the storage condition of
Anastrozole EP Impurity A Q: What are the applications of
Anastrozole EP Impurity A | [Molecular Formula]
C16H17N5 | [MDL Number]
MFCD20278235 | [MOL File]
1215780-15-6.mol | [Molecular Weight]
279.34 |
| Chemical Properties | Back Directory | [Boiling point ]
477.5±55.0 °C(Predicted) | [density ]
1.11±0.1 g/cm3(Predicted) | [storage temp. ]
Refrigerator | [solubility ]
Chloroform, Methanol (Very Slightly) | [form ]
Thick Oil | [pka]
2.63±0.10(Predicted) | [color ]
Colorless to Pale Beige | [InChI]
InChI=1S/C16H17N5/c1-12(7-17)14-4-13(8-21-11-19-10-20-21)5-15(6-14)16(2,3)9-18/h4-6,10-12H,8H2,1-3H3 | [InChIKey]
LXXANTDQIIXQBZ-UHFFFAOYSA-N | [SMILES]
c1c(C[n]2ncnc2)cc(C(C)(C#N)C)cc1C(C#N)C |
|
| Company Name: |
Aavyan Labs
|
| Tel: |
+91-9652399498 |
| Website: |
www.www.NOWEBSITE |
| Company Name: |
OPULENT PHARMA
|
| Tel: |
+91-9106692785 |
| Website: |
www.www.NOWEBSITE |
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
|