| Identification | Back Directory | [Name]
4-METHOXY-3-MORPHOLIN-4-YLMETHYL-BENZALDEHYDE | [CAS]
128501-81-5 | [Synonyms]
AKOS B000991 TIMTEC-BB SBB000738 ART-CHEM-BB B000991 4-Methoxy-3-(morpholinomethyl)benzaldehyde 4-METHOXY-3-(4-MORPHOLINYLMETHYL)BENZALDEHYDE 4-METHOXY-3-MORPHOLIN-4-YLMETHYL-BENZALDEHYDE Benzaldehyde, 4-methoxy-3-(4-morpholinylmethyl)- | [Molecular Formula]
C13H17NO3 | [MDL Number]
MFCD00442737 | [MOL File]
128501-81-5.mol | [Molecular Weight]
235.28 |
| Chemical Properties | Back Directory | [form ]
solid | [InChI]
1S/C13H17NO3/c1-16-13-3-2-11(10-15)8-12(13)9-14-4-6-17-7-5-14/h2-3,8,10H,4-7,9H2,1H3 | [InChIKey]
YHRYKKIGMYJYLB-UHFFFAOYSA-N | [SMILES]
COC1=CC=C(C=O)C=C1CN2CCOCC2 |
| Hazard Information | Back Directory | [Uses]
4-Methoxy-3-(morpholin-4-ylmethyl)benzaldehyde is used in the synthesis of 2-Aryl 1,2-Dihydro-4(3H)-quinazoline derivative possessing anticancer and antiparasitic activities and capable of preventing the progress of neurodegenerative diseases. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
| Company Name: |
Matrix Scientific
|
| Tel: |
803 788-9494 All other calls |
| Website: |
www.matrixscientific.com |
| Company Name: |
Specs
|
| Tel: |
+31 15 251 8111 |
| Website: |
www.specs.net |
| Company Name: |
Fluorochem Ltd
|
| Tel: |
(01457) 868921 (4 lines) |
| Website: |
www.fluorochem.co.uk |
| Company Name: |
AsInEx Ltd.
|
| Tel: |
+7 495 780 3410 |
| Website: |
www.asinex.com |
|