| Identification | Back Directory | [Name]
RAFT dithiobenzoate | [CAS]
129841-40-3 | [Synonyms]
RAFT dithiobenzoate Ethyl 2-(4-methoxyphenylcarbonothioylthio)acetate (4-Methoxy-thiobenzoylsulfanyl)-aceticacidethylester Ethyl 2-(4-methoxyphenylcarbonothioylthio)acetate 99% 2-[(4-Methoxyphenylthioxomethyl)thio]ethanoic acid ethyl ester Acetic acid, 2-[[(4-methoxyphenyl)thioxomethyl]thio]-, ethyl ester | [Molecular Formula]
C12H14O3S2 | [MDL Number]
MFCD23144322 | [MOL File]
129841-40-3.mol | [Molecular Weight]
270.37 |
| Chemical Properties | Back Directory | [Melting point ]
30-35°C | [Boiling point ]
374.1±52.0 °C(Predicted) | [density ]
1.230±0.06 g/cm3(Predicted) | [Fp ]
>110℃ | [storage temp. ]
2-8°C | [form ]
liquid | [InChI]
1S/C12H14O3S2/c1-3-15-11(13)8-17-12(16)9-4-6-10(14-2)7-5-9/h4-7H,3,8H2,1-2H3 | [InChIKey]
YZSCQGUNDFCXBR-UHFFFAOYSA-N | [SMILES]
CCOC(=O)CSC(=S)c1ccc(OC)cc1 |
| Hazard Information | Back Directory | [Uses]
RAFT agent for controlled radical polymerization; especially suited for the polymerization of methacrylate and methacrylamide monomers. Chain Transfer Agent (CTA) with electron donating group to increase fragmentation and reduce polymerization time. | [General Description]
Need help choosing the correct RAFT Agent? Please consult the RAFT Agent to Monomer compatibility table. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Cochemical Ltd.
|
| Tel: |
029-86115547 17791676824 |
| Website: |
http://www.cochemical.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|