| Identification | Back Directory | [Name]
2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol | [CAS]
1309980-11-7 | [Synonyms]
3-(2-Hydroxy-2-propyl)phenylboronic Acid Pinacol Ester 3-(2-Hydroxypropan-2-yl)phenylboronic acid pinacol ester 2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol Benzenemethanol, α,α-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | [Molecular Formula]
C15H23BO3 | [MDL Number]
MFCD12405017 | [MOL File]
1309980-11-7.mol | [Molecular Weight]
262.15 |
| Chemical Properties | Back Directory | [Melting point ]
64-69°C | [Boiling point ]
374.5±25.0 °C(Predicted) | [density ]
1.04±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
solid | [pka]
14.48±0.29(Predicted) | [Appearance]
White to off-white Solid | [InChI]
1S/C15H23BO3/c1-13(2,17)11-8-7-9-12(10-11)16-18-14(3,4)15(5,6)19-16/h7-10,17H,1-6H3 | [InChIKey]
NNPQWBXXZHNLAW-UHFFFAOYSA-N | [SMILES]
CC(C)(O)c1cccc(c1)B2OC(C)(C)C(C)(C)O2 |
| Hazard Information | Back Directory | [Uses]
3-(2-Hydroxy-2-propanyl)phenylboronic acid pinacol ester can be used as an intermediate in the synthesis of furo[3,2-b]pyridine derivatives as potent kinase inhibitors. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|