| Identification | Back Directory | [Name]
Lithium Bis(pentafluoroethanesulfonyl)imide | [CAS]
132843-44-8 | [Synonyms]
LiBETI Lithium bis(pentafluoroethylsulfonyl)imide Lithium Bis(pentafluoroethanesulfonyl)imide Bis(pentafluoroethanesulfonyl)imide Lithium Salt | [EINECS(EC#)]
686-525-1 | [Molecular Formula]
C4F10LiNO4S2 | [MDL Number]
MFCD22374096 | [MOL File]
132843-44-8.mol | [Molecular Weight]
387.102 |
| Chemical Properties | Back Directory | [Melting point ]
328°C(lit.) | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C4F10NO4S2.Li/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;/q-1;+1 | [InChIKey]
ACFSQHQYDZIPRL-UHFFFAOYSA-N | [SMILES]
[Li+].[N-](S(C(F)(F)C(F)(F)F)(=O)=O)S(C(F)(F)C(F)(F)F)(=O)=O | [CAS DataBase Reference]
132843-44-8 | [EPA Substance Registry System]
Ethanesulfonamide, 1,1,2,2,2-pentafluoro-N-[(pentafluoroethyl)sulfonyl]-, lithium salt (132843-44-8) |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|