| Identification | Back Directory | [Name]
Atazanavir EP Impurity G | [CAS]
1332981-16-4 | [Synonyms]
12-Epi Atazanavir
(R,S,S,S)-Atazanavir
Atazanavir EP Impurity G
(3S,8S,9S,12R)-Atazanavir
Atazanavir (3S,8S,9S,12R)-Isomer
Atazanavir S,S,S,R-Diastereomer Analog
Atazanavir Impurity 2（(3S,8S,9S,12R)-Atazanavir）
Atazanavir (3S,8S,9S,12R)-Isomer (12-Epi Atazanavir)
(3S,8S,9S,12R) AtazanavirQ: What is
(3S,8S,9S,12R) Atazanavir Q: What is the CAS Number of
(3S,8S,9S,12R) Atazanavir Q: What is the storage condition of
(3S,8S,9S,12R) Atazanavir Q: What are the applications of
(3S,8S,9S,12R) Atazanavir | [Molecular Formula]
C38H52N6O7 | [MOL File]
1332981-16-4.mol | [Molecular Weight]
704.86 |
| Chemical Properties | Back Directory | [density ]
1.178±0.06 g/cm3(Predicted) | [pka]
11.11±0.46(Predicted) | [InChIKey]
AXRYRYVKAWYZBR-RTNMLALUSA-N | [SMILES]
C(OC)(=O)N[C@@H](C(C)(C)C)C(=O)NN(CC1=CC=C(C2=NC=CC=C2)C=C1)C[C@H](O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](C(C)(C)C)NC(OC)=O |
| Hazard Information | Back Directory | [Uses]
(3S,8S,9S,12R)-Atazanavir is an impurity of Atazanavir (A790051); a novel azapeptide HIV protease inhibitor (PI) and antiviral agent. |
|
| Company Name: |
Roark Standards
|
| Telephone: |
0755-83552066 15986688328 |
| Website: |
roarkstandards.com |
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
|