| Identification | Back Directory | [Name]
1,1-DIOXOBENZO[B]THIOPHEN-2-YLMETHYL CHLOROFORMATE | [CAS]
135204-19-2 | [Synonyms]
Bsmoc-Cl 1 1-DIOXOBENZO(B)THIOPHEN-2-YLMETHYL Benzothiophenesulfone-2-Methyl ChloroforMate 1,1-DIOXOBENZO[B]THIOPHEN-2-YLMETHYL CHLOROFORMATE Benzo[b]thiophenesulfone-2-methoxycarbonylchloride 1,1-DIOXOBENZO[B]THIOPHEN-2-YLMETHYL CHLOROFORMATE, TECH. 90 1,1-Dioxobenzobüthiophen-2-ylmethyl chloroformate, tech. 90% 1,1-DIOXOBENZO[B]THIOPHEN-2-YLMETHYL CHLOROFORMATE: TECH., 90% Benzo[b]thiophenesulfone-2-methoxycarbonyl chloride, Bsmoc-Cl Carbonochloridic acid benzo[b]thien-2-ylmethyl ester S,S-dioxide Carbonochloridic acid, (1,1-dioxidobenzo[b]thien-2-yl)methyl ester | [EINECS(EC#)]
-0 | [Molecular Formula]
C10H7ClO4S | [MDL Number]
MFCD01090984 | [MOL File]
135204-19-2.mol | [Molecular Weight]
258.68 |
| Chemical Properties | Back Directory | [Melting point ]
76-77°C | [Boiling point ]
433.2±45.0 °C(Predicted) | [density ]
1.532±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [Water Solubility ]
Reacts with water. | [Sensitive ]
Moisture Sensitive | [BRN ]
8258946 | [InChI]
InChI=1S/C10H7ClO4S/c11-10(12)15-6-8-5-7-3-1-2-4-9(7)16(8,13)14/h1-5H,6H2 | [InChIKey]
ZYXGPSYADVTJGF-UHFFFAOYSA-N | [SMILES]
C(Cl)(OCC1S(=O)(=O)C2=CC=CC=C2C=1)=O | [CAS DataBase Reference]
135204-19-2 |
| Hazard Information | Back Directory | [Uses]
1,1-Dioxobenzo[b]thiophen-2-ylmethyl chloroformate is used for protection of amino acids as their benzothiophenesulfone-2-methoxycarbonyl (Bsmoc) derivatives, which represent a significant improvement in solid-phase peptide synthesis over the corresponding Fmoc derivatives. |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|