| Identification | Back Directory | [Name]
3,4'-Dihexyl-2,2'-bithiophene | [CAS]
135926-93-1 | [Synonyms]
3,4'-Dihexyl-2,2'-bithiophene 2,2'-Bithiophene, 3,4'-dihexyl- 3,4'-Dihexyl-2,2'-bithiophene> 3,4'-Dihexyl-2,2'-bithiophene ISO 9001:2015 REACH | [Molecular Formula]
C20H30S2 | [MDL Number]
MFCD15072161 | [MOL File]
135926-93-1.mol | [Molecular Weight]
334.582 |
| Chemical Properties | Back Directory | [Boiling point ]
165°C/0.02mmHg | [density ]
1.009±0.06 g/cm3(Predicted) | [refractive index ]
1.5510-1.5550 | [storage temp. ]
0-10°C | [form ]
clear liquid | [color ]
White to Amber to Dark green | [λmax]
297nm(CHCl3)(lit.) | [InChI]
InChI=1S/C20H30S2/c1-3-5-7-9-11-17-15-19(22-16-17)20-18(13-14-21-20)12-10-8-6-4-2/h13-16H,3-12H2,1-2H3 | [InChIKey]
FWQMKAFKIYUBKB-UHFFFAOYSA-N | [SMILES]
C1(C2SC=C(CCCCCC)C=2)SC=CC=1CCCCCC |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
China Langchem Inc.
|
| Tel: |
0086-21-58956006 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19141/0_EN.htm |
|