| Identification | Back Directory | [Name]
tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate | [CAS]
1363381-20-7 | [Synonyms]
2-Boc-5-oxa-2,8-diaza-spiro[3.5]nonan-7-one tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate 5-Oxa-2,8-diazaspiro[3.5]nonane-2-carboxylic acid, 7-oxo-, 1,1-dimethylethyl ester | [Molecular Formula]
C11H18N2O4 | [MDL Number]
MFCD22566166 | [MOL File]
1363381-20-7.mol | [Molecular Weight]
242.27 |
| Chemical Properties | Back Directory | [storage temp. ]
Sealed in dry,Room Temperature | [InChI]
InChI=1S/C11H18N2O4/c1-10(2,3)17-9(15)13-6-11(7-13)5-12-8(14)4-16-11/h4-7H2,1-3H3,(H,12,14) | [InChIKey]
XVGAQOILVLJWLR-UHFFFAOYSA-N | [SMILES]
C1C2(CNC(=O)CO2)CN1C(OC(C)(C)C)=O |
| Hazard Information | Back Directory | [Uses]
Tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate is a reactant used in the efficient preparation of diverse array of amino alcohol chiral fragments. |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
|