| Identification | Back Directory | [Name]
TERT-BUTYL TETRAISOPROPYLPHOSPHORODIAMIDITE | [CAS]
137348-88-0 | [Synonyms]
TERT-BUTYL TETRAISOPROPYLPHOSPHORODIAMIDITE tert-Butyl tetraisopropylphosphorodiamidite 95% [tert-butyloxy]bis(N,N-diisopropylamino)phosphane tert-Butyl-N,N,N',N'-tetraisopropylphosphorodiamidite Phosphorodiamidous acid, N,N,N',N'-tetrakis(1-methylethyl)-, 1,1-dimethylethyl ester N-[[di(propan-2-yl)amino]-[(2-methylpropan-2-yl)oxy]phosphanyl]-N-propan-2-ylpropan-2-amine | [Molecular Formula]
C16H37N2OP | [MDL Number]
MFCD00674022 | [MOL File]
137348-88-0.mol | [Molecular Weight]
304.45 |
| Chemical Properties | Back Directory | [Melting point ]
67-74 °C (lit.) | [Boiling point ]
330.1±25.0 °C(Predicted) | [storage temp. ]
2-8°C | [form ]
solid | [pka]
7.68±0.70(Predicted) | [InChI]
InChI=1S/C16H37N2OP/c1-12(2)17(13(3)4)20(19-16(9,10)11)18(14(5)6)15(7)8/h12-15H,1-11H3 | [InChIKey]
PSFUFSJCFKUIIG-UHFFFAOYSA-N | [SMILES]
P(N(C(C)C)C(C)C)(N(C(C)C)C(C)C)OC(C)(C)C |
| Hazard Information | Back Directory | [Uses]
tert-Butyl Tetraisopropylphosphorodiamidite acts as a reagent in the synthesis of aromatic oxophosphorus compounds via michaelis-arbov type of reaction of arynes. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18086626237 18086626237 |
| Website: |
www.chemicalbook.com/showsupplierproductslist16955/0.htm |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
|