| Identification | Back Directory | [Name]
[4-(4-phosphonophenyl)phenyl]phosphonic acid | [CAS]
13817-79-3 | [Synonyms]
Biphenyl-4,4'-diphosphonic acid 4,4'-biphenylenebisphosphonic acid 4-(4-phosphonophenyl)phenyl]phosphonicaci [1,1'-biphenyl]-4,4'-diyldiphosphonic acid [4-(4-phosphonophenyl)phenyl]phosphonic acid 1,1'-Biphenyl]-4,4'-diylbis(phosphonic acid) 1,1'-Biphenyl]-4,4'-diylbis(phosphonic acid) Phosphonic acid,P,P'-[1,1'-biphenyl]-4,4'-diylbis- | [Molecular Formula]
C12H12O6P2 | [MDL Number]
MFCD00968649 | [MOL File]
13817-79-3.mol | [Molecular Weight]
314.17 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C | [Boiling point ]
634.5±65.0 °C(Predicted) | [density ]
1?+-.0.1 g/cm3(Predicted) | [storage temp. ]
Store at room temperature | [form ]
powder | [pka]
1.47±0.10(Predicted) | [color ]
white | [InChI]
1S/C12H12O6P2/c13-19(14,15)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(16,17)18/h1-8H,(H2,13,14,15)(H2,16,17,18) | [InChIKey]
QWSZMKCGMDROKE-UHFFFAOYSA-N | [SMILES]
[P](=O)(O)(O)c1ccc(cc1)c2ccc(cc2)[P](=O)(O)O |
| Hazard Information | Back Directory | [Uses]
These products are used as linkers to improve adhesion between coatings and metal surfaces. The phosphonic acid groups can graft onto metal surface while the hydroxyl groups react with common epoxy/amine-based paints. |
|
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
|