| Identification | Back Directory | [Name]
N-(1 H-BENZOTRIAZOL-1-YLPHENYLMETHYL)-3-PYRIDINECARBOXAMIDE | [CAS]
138768-28-2 | [Synonyms]
TIMTEC-BB SBB006467 N-(1H-benzotriazol-1-ylphenylmethyl)-3-pyridineca N-<α-(benzotriazol-1-yl)benzyl>-3-pyridinecarboxamide N-(1 H-BENZOTRIAZOL-1-YLPHENYLMETHYL)-3-PYRIDINECARBOXAMIDE N-((1H-Benzo[d][1,2,3]triazol-1-yl)(phenyl)methyl)nicotinamide N-(1H-Benzotriazol-1-ylphenylmethyl)-3-pyridinecarboxamide 97% | [Molecular Formula]
C19H15N5O | [MDL Number]
MFCD00205103 | [MOL File]
138768-28-2.mol | [Molecular Weight]
329.36 |
| Chemical Properties | Back Directory | [Melting point ]
184-188 °C(lit.) | [Boiling point ]
650.1±55.0 °C(Predicted) | [density ]
1.31±0.1 g/cm3(Predicted) | [pka]
11.46±0.46(Predicted) | [InChI]
1S/C19H15N5O/c25-19(15-9-6-12-20-13-15)21-18(14-7-2-1-3-8-14)24-17-11-5-4-10-16(17)22-23-24/h1-13,18H,(H,21,25) | [InChIKey]
BABUDAQOHSIBJR-UHFFFAOYSA-N | [SMILES]
O=C(NC(c1ccccc1)n2nnc3ccccc23)c4cccnc4 |
| Hazard Information | Back Directory | [Uses]
N-(1H-Benzotriazol-1-ylphenylmethyl)-3-pyridinecarboxamide can be used as an amidoalkylating reagent for the preparation of amidoalkylated products of aromatic and heterocyclic compounds. | [reaction suitability]
reaction type: C-C Bond Formation |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|