| Identification | Back Directory | [Name]
FRANGULIN B | [CAS]
14101-04-3 | [Synonyms]
FRANGULIN B RAHMNOXANTHIN Einecs 237-953-9 EModin 6-apioside EMODIN-L-RHAMNOSIDE EMODIN-6-O-APIOSIDE EMODIN-6-(L)-O-APIOSIDE 6-o-(D-Apiofuranosyl)-1,6,8-trihydroxy-3-methylanthraquinone 3-(D-Apio-beta-D-furanosyloxy)-1,8-dihydroxy-6-methylanthraquinone 3-(D-apio-.betascsc.-furanosyloxy)-1,8-dihydroxy-6-methylanthraquinone 3-(D-Apio-β-D-furanosyloxy)-1,8-dihydroxy-6-methyl-9,10-anthracenedione 9,10-Anthracenedione, 3-(D-apio-β-D-furanosyloxy)-1,8-dihydroxy-6-methyl- 3-[[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)-2-oxolanyl]oxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione | [EINECS(EC#)]
237-953-9 | [Molecular Formula]
C20H18O9 | [MDL Number]
MFCD00016362 | [MOL File]
14101-04-3.mol | [Molecular Weight]
402.35 |
| Chemical Properties | Back Directory | [Melting point ]
196℃ | [Boiling point ]
774.6±60.0 °C(Predicted) | [density ]
1.655±0.06 g/cm3 (20 ºC 760 Torr) | [storage temp. ]
2-8°C | [form ]
neat | [pka]
6.01±0.20(Predicted) | [InChI]
1S/C20H18O9/c1-8-2-10-14(12(22)3-8)17(25)15-11(16(10)24)4-9(5-13(15)23)29-19-18(26)20(27,6-21)7-28-19/h2-5,18-19,21-23,26-27H,6-7H2,1H3/t18-,19-,20+/m0/s1 | [InChIKey]
AEQMIFRODRFTJF-SLFFLAALSA-N | [SMILES]
OC[C@]1(O)[C@@H](O)[C@@H](OC1)OC2=CC(O)=C3C(C(C(C=C(C)C=C4O)=C4C3=O)=O)=C2 | [LogP]
3.660 (est) |
| Hazard Information | Back Directory | [Uses]
Frangulin B is an anthraquinone derivative that has been investigated for having anti-inflammatory effects, and as a natural product from Formosan plants acting as an Inhibitor of DNA Methyltransferase. | [Definition]
ChEBI: Frangulin B is an anthraquinone. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|