| Identification | Back Directory | [Name]
N,N'-BIS(SALICYLIDENE)ETHYLENEDIAMINONICKEL(II) | [CAS]
14167-20-5 | [Synonyms]
Nickel(II) salen N,N'-Ethylenebis(salicylideniminato)nickel Bis(salicylaldehyde)ethylenediiminatonickel Nickel, [N,N'-ethylenebis(salicylaldiminato)]- N,N'-BIS(SALICYLIDENE)ETHYLENEDIAMINONICKEL(II) [[α,α′-(Ethylenedinitrilo)di-o-cresolato](2-)]nickel Nickel, [[alpha,alpha'-(ethylenedinitrilo)di-o-cresolato](2-)]- [[2,2′-[1,2-Ethanediylbis[(nitrilo-κN)methylidyne]]bis[phenolato-κO]](2-)]nickel Nickel, [[2,2'-[1,2-ethanediylbis(nitrilomethylidyne)]bis[phenolato]](2-)-N,N',O,O']-, (SP-4-2)- | [Molecular Formula]
C16H14N2NiO2 | [MDL Number]
MFCD00012041 | [MOL File]
14167-20-5.mol | [Molecular Weight]
324.99 |
| Chemical Properties | Back Directory | [Melting point ]
>150 °C (decomp) | [InChI]
InChI=1S/C16H16N2O2.Ni/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/q;+2/p-2/b17-11+,18-12+; | [InChIKey]
DKBSGGSJQXGHBV-OYJDLGDISA-L | [SMILES]
C12C=CC=CC=1C=NCCN=CC1C=CC=CC=1O[Ni]O2 |t:7,11| |
| Hazard Information | Back Directory | [Uses]
Catalyst for:
- Covalent functionalization of multiwall carbon nanotubes
- Reduction reactions
- Epoxidation reactions
- Reduction and intramolecular cyclization
| [Synthesis Reference(s)]
[1]Goedken, V. L.; Weiss, M. C. Inorg. Synth. 1980, 20, 115.
| [reaction suitability]
core: nickel reagent type: catalyst | [Synthesis]
N,N′-Bis(salicylidene)ethylenediaminenickel(II) is easily and cheaply prepared from ethylenediamine, salicylaldehyde, and Ni(OAc)2.[1] | [storage]
N,N′-Bis(salicylidene)ethylenediaminenickel(II) is low sensitivity to air and water; cancer suspect agent; handle with care.
|
|
| Company Name: |
Rhawn Reagent Gold
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Amkchem Limited
|
| Tel: |
微信:17321281695 18019252918 |
| Website: |
www.amkchem.com |
|