| Identification | Back Directory | [Name]
ANILINE-D7 | [CAS]
14545-23-4 | [Synonyms]
ANILINE-D7 [2H7]aniline Benzeneamine-d7 (2H7)Benzenamine Aniline-d7 ANILINE-D7, 98 ATOM % D (2,3,4,5,6,N,N-2H7)Aniline Aniline-d7,for NMR,99 atom% D Aniline-d7, 99 atom% D, for NMR Aniline-d7
(Discontinued, see A662477) (2,3,4,5,6-2H5)Benzene-1-(N,N-2H2)amine | [EINECS(EC#)]
238-580-4 | [Molecular Formula]
C6D7N | [MDL Number]
MFCD00084117 | [MOL File]
14545-23-4.mol | [Molecular Weight]
100.17 |
| Chemical Properties | Back Directory | [Appearance]
colourless to light yellow liquid | [Melting point ]
-6 °C(lit.)
| [Boiling point ]
184 °C(lit.)
| [density ]
1.098 g/mL at 25 °C
| [refractive index ]
n20/D 1.5824(lit.)
| [Fp ]
158 °F
| [storage temp. ]
2-8°C | [Stability:]
Stable, but light sensitive. May discolour upon exposure to air or light. Incompatible with oxidizing agents, bases, iron, iron salts, aluminium, zinc. | [InChI]
1S/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2/i1D,2D,3D,4D,5D/hD2 | [InChIKey]
PAYRUJLWNCNPSJ-LQHBDRBESA-N | [SMILES]
[2H]N([2H])c1c([2H])c([2H])c([2H])c([2H])c1[2H] | [EPA Substance Registry System]
Aniline-d7 (14545-23-4) | [CAS Number Unlabeled]
62-53-3 |
| Hazard Information | Back Directory | [Chemical Properties]
colourless to light yellow liquid | [Uses]
Aniline is used in the manufacture of dyes, medicinals, resins, varnishes, perfumes, as a vulcanizing rubber or even as a solvent. This is the deuterium labeled analog. | [Synthesis]
Aniline-d7 was prepared as follows: in the reaction flask add aniline 10mmol, heavy water 20mL and SOCl20.3mL in turn, reflux reaction 24h. cooled to room temperature, TLC detected the reaction was complete [unfolding agent: A = V (ethyl acetate): V (petr |
|
| Company Name: |
China Langchem Inc.
|
| Tel: |
021-58956006,021-58950017 15800617331 |
| Website: |
www.isotopemall.com/ |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|