| Identification | Back Directory | [Name]
α-Descyclohexyl-α-phenyl Oxybutynin | [CAS]
14943-53-4 | [Synonyms]
Oxybutynin EP Imp B
Oxybutynin IMpurity B
Oxybutynin EP Impurity B
α-Descyclohexyl-α-phenyl Oxybutynin
4-(Diethylamino)but-2-ynyl 2-Hydrox
α-Descyclohexyl-α-phenyl Oxybutynin
Oxybutynin Hydrochloride Impurity B
Oxybutynin hydrochloride EP impurity B
ALPHA-DESCYCLOHEXYL-ALPHA-PHENYL OXYBUTYNIN
Benzilic Acid 4-(DiethylaMino)-2-butynyl Ester
Oxybutynin Impurity 2（Oxybutynin EP Impurity B）
4-(DiethylaMino)-2-butyn-1-ol Benzilate (Ester)
4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate
Oxybutynin EP Impurity B (Diphenyl Analogue of Oxybutynin)
4-(diethylamino)but-2-yn-1-yl 2-hydroxy-2,2-diphenylacetate
Benzeneacetic acid, α-hydroxy-α-phenyl-, 4-(diethylamino)-2-butyn-1-yl ester
Oxybutynin Impurity BQ: What is
Oxybutynin Impurity B Q: What is the CAS Number of
Oxybutynin Impurity B Q: What is the storage condition of
Oxybutynin Impurity B Q: What are the applications of
Oxybutynin Impurity B | [Molecular Formula]
C22H25NO3 | [MOL File]
14943-53-4.mol | [Molecular Weight]
351.44 |
| Chemical Properties | Back Directory | [Melting point ]
78-79°C | [Boiling point ]
447.0±38.0 °C(Predicted) | [density ]
1.134±0.06 g/cm3(Predicted) | [storage temp. ]
Refrigerator | [solubility ]
Chloroform (Slightly), Ethyl Acetate (Slightly) | [form ]
Solid | [pka]
11.13±0.29(Predicted) | [color ]
White to Off-White | [Major Application]
pharmaceutical small molecule | [InChI]
1S/C22H25NO3/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-16,25H,3-4,17-18H2,1-2H3 | [InChIKey]
YGGLNZUXAWIXQH-UHFFFAOYSA-N | [SMILES]
CCN(CC)CC#CCOC(C(C1=CC=CC=C1)(O)C2=CC=CC=C2)=O |
| Hazard Information | Back Directory | [Chemical Properties]
White Solid | [Uses]
Oxybutynin impurity; 4-(dialkylamino)-2-butynyl benzilates | [Uses]
α-Descyclohexyl-α-phenyl Oxybutynin (Oxybutynin EP Impurity B) is an Oxybutynin impurity; 4-(dialkylamino)-2-butynyl benzilates as parasympatholytic substances. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
|