| Identification | Back Directory | [Name]
tris(2-methoxyethyl) orthoborate | [CAS]
14983-42-7 | [Synonyms]
Einecs 239-064-1
tris(2-mrthoxyethyl)borate
tris(2-methoxyethyl) borate
Tris(2-methoxyethoxy) boron
Tris(2-methoxyethoxy)borane
tris(2-methoxyethyl) orthoborate
Tris(2-methoxyethyl)orthoborate (>
Boric acid tris(2-methoxyethyl) ester
Tris(2-methoxyethyl)orthoborate (>90%)
Ethanol, 2-methoxy-, triester with boric acid (H3bo3)
Ethanol, 2-methoxy-, 1,1',1''-triester with boric acid (H3bo3) | [EINECS(EC#)]
239-064-1 | [Molecular Formula]
C9H21BO6 | [MOL File]
14983-42-7.mol | [Molecular Weight]
236.07 |
| Chemical Properties | Back Directory | [Boiling point ]
123-125 °C(Press: 1.5 Torr) | [density ]
1.029 g/cm3(Temp: 25 °C) | [refractive index ]
1.4138 | [Fp ]
113°C (235°F) | [storage temp. ]
Hygroscopic, Refrigerator, under inert atmosphere | [solubility ]
Benzene (Slightly), Chloroform (Slightly), Methanol (Slightly, Heated) | [form ]
Oil | [color ]
Colourless | [Specific Gravity]
1.029 | [Stability:]
Moisture Sensitive | [InChI]
InChI=1S/C9H21BO6/c1-11-4-7-14-10(15-8-5-12-2)16-9-6-13-3/h4-9H2,1-3H3 | [InChIKey]
IYGPXXORQKFXCZ-UHFFFAOYSA-N | [SMILES]
B(OCCOC)(OCCOC)OCCOC | [EPA Substance Registry System]
Ethanol, 2-methoxy-, triester with boric acid (H3BO3) (14983-42-7) |
| Hazard Information | Back Directory | [Uses]
Tris(2-methoxyethyl)orthoborate (>90%) can be used to produce a dynamic polymer with hybrid crosslinked structure for damping and cushioning materials, impact-?resistant protective materials, shape memory materials, self-?repairing materials and tough materials. |
|
| Company Name: |
AllyChem Co., Ltd.
|
| Telephone: |
0411-62313318 13889470786 |
| Website: |
www.chemicalbook.com/showsupplierproductslist677/0_en.htm |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-29-81139210 17389186172 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-219/ |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
| Company Name: |
Aobolihui
|
| Telephone: |
0917-18691729 18691729963 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList957491/0_EN.htm |
|