| Identification | Back Directory | [Name]
2,4-dihydroxy-Butanoic acid | [CAS]
1518-62-3 | [Synonyms]
2,4-dihydroxybutanoic acid
2,4-dihydroxy-Butanoic acid
Butanoic acid, 2,4-dihydroxy-
2,4-Dihydroxy-butyric acid calcium salt | [Molecular Formula]
C4H8O4 | [MDL Number]
MFCD24392009 | [MOL File]
1518-62-3.mol | [Molecular Weight]
120.1 |
| Chemical Properties | Back Directory | [Melting point ]
167-169 °C | [Boiling point ]
412.0±30.0 °C(Predicted) | [density ]
1.420±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
3.71±0.10(Predicted) | [Major Application]
clinical testing | [InChI]
InChI=1S/C4H8O4/c5-2-1-3(6)4(7)8/h3,5-6H,1-2H2,(H,7,8) | [InChIKey]
UFYGCFHQAXXBCF-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C(O)CCO |
| Hazard Information | Back Directory | [Uses]
(S)-2,4-Dihydroxybutanoic Acid Lithium Salt is a building block used in synthesis of various compounds. | [Definition]
ChEBI: A omega-hydroxy fatty acid that is butyric acid substituted by hydroxy groups at positions 2 and 4 respectively. | [Biological Activity]
Various cases of succinic semialdehyde dehydrogenase deficiency have shown consistently increased amounts of this metabolitewhile 2,4-dihydroxybutanoic acid is usually absent in normal human urine extracts or in only trace constituents in neonates. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|